Products 346729-48-4
CAS 346729-48-4 is the registry number for 1-(3-Chloro-5-(trifluoromethyl)phenyl)piperazine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[3-chloro-5-(trifluoromethyl)phenyl]piperazine (CAS 346729-48-4) is a chemical compound with the molecular formula C11H12ClF3N2 and a molecular weight of 264.67 g/mol. IUPAC name: 1-[3-chloro-5-(trifluoromethyl)phenyl]piperazine. InChIKey: DDWYBHPNFVYDDC-UHFFFAOYSA-N.
| Molecular formula | C11H12ClF3N2 |
|---|---|
| Molecular weight | 264.67 g/mol |
| IUPAC name | 1-[3-chloro-5-(trifluoromethyl)phenyl]piperazine |
| InChIKey | DDWYBHPNFVYDDC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=CC(=C2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)