Products 122-30-5
CAS 122-30-5 appears in our catalog under these names: Sinapine hydroxide, Sinapine (hydroxide). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 25mg, 10mg.
2-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxyethyl-trimethylazanium hydroxide (CAS 122-30-5) is a chemical compound with the molecular formula C16H25NO6 and a molecular weight of 327.37 g/mol. IUPAC name: 2-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxyethyl-trimethylazanium hydroxide. InChIKey: NOZUYJMVDJBABT-UHFFFAOYSA-N.
| Molecular formula | C16H25NO6 |
|---|---|
| Molecular weight | 327.37 g/mol |
| IUPAC name | 2-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxyethyl-trimethylazanium hydroxide |
| InChIKey | NOZUYJMVDJBABT-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCOC(=O)/C=C/C1=CC(=C(C(=C1)OC)O)OC.[OH-] |
Computed by PubChem (NCBI)
Synonyms:
Sinapine hydroxide, Sinapine (hydroxide)