CAS 122-47-4 is the registry number for 3,4-Dimethoxy-beta-methyl-beta-nitrostyrene. Offered by: TRC. Available pack sizes: 250mg.
1,2-dimethoxy-4-[(E)-2-nitroprop-1-enyl]benzene (CAS 122-47-4) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 1,2-dimethoxy-4-[(E)-2-nitroprop-1-enyl]benzene. InChIKey: JGFBGRHDJMANRR-SOFGYWHQSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 1,2-dimethoxy-4-[(E)-2-nitroprop-1-enyl]benzene |
| InChIKey | JGFBGRHDJMANRR-SOFGYWHQSA-N |
| SMILES | C/C(=C\C1=CC(=C(C=C1)OC)OC)/[N+](=O)[O-] |
Computed by PubChem (NCBI)