Products 1220-80-0

CAS 1220-80-0 appears in our catalog under these names: (S)-4-Methyl-2-(4-methylphenylsulfonamido)pentanoic acid, 95+%, (2S)-4-Methyl-2-(4-methylbenzenesulfonamido)pentanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

(2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoic acid (CAS 1220-80-0) is a chemical compound with the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. IUPAC name: (2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoic acid. InChIKey: DNBHSCLUHQKGMD-LBPRGKRZSA-N.

Identity
Molecular formulaC13H19NO4S
Molecular weight285.36 g/mol
IUPAC name(2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoic acid
InChIKeyDNBHSCLUHQKGMD-LBPRGKRZSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CC(C)C)C(=O)O

Computed by PubChem (NCBI)