Products 1220017-89-9
CAS 1220017-89-9 is the registry number for 5-Bromo-4-methyl-N-(p-tolyl)pyridin-2-amine, 95+%. Offered by: Ambeed, BLDpharm. Available pack sizes: 1g.
5-bromo-4-methyl-N-(4-methylphenyl)pyridin-2-amine (CAS 1220017-89-9) is a chemical compound with the molecular formula C13H13BrN2 and a molecular weight of 277.16 g/mol. IUPAC name: 5-bromo-4-methyl-N-(4-methylphenyl)pyridin-2-amine. InChIKey: PAFZAKULGBLXHU-UHFFFAOYSA-N.
| Molecular formula | C13H13BrN2 |
|---|---|
| Molecular weight | 277.16 g/mol |
| IUPAC name | 5-bromo-4-methyl-N-(4-methylphenyl)pyridin-2-amine |
| InChIKey | PAFZAKULGBLXHU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=NC=C(C(=C2)C)Br |
Computed by PubChem (NCBI)