CAS 1338718-34-5 is the registry number for 5-Chloro-1-ethyl-4-nitro-1H-pyrazole, 95+%. Offered by: AmBeed. Available pack sizes: 100mg, 5g.
5-chloro-1-ethyl-4-nitropyrazole (CAS 1338718-34-5) is a chemical compound with the molecular formula C5H6ClN3O2 and a molecular weight of 175.57 g/mol. IUPAC name: 5-chloro-1-ethyl-4-nitropyrazole. InChIKey: AGWUMLSWBDBGLI-UHFFFAOYSA-N.
| Molecular formula | C5H6ClN3O2 |
|---|---|
| Molecular weight | 175.57 g/mol |
| IUPAC name | 5-chloro-1-ethyl-4-nitropyrazole |
| InChIKey | AGWUMLSWBDBGLI-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C=N1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)