CAS 1220219-19-1 is the registry number for 3-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)propanenitrile, 95+%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanenitrile (CAS 1220219-19-1) is a chemical compound with the molecular formula C15H20BNO2 and a molecular weight of 257.14 g/mol. IUPAC name: 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanenitrile. InChIKey: OGOXYOXLPUUTJM-UHFFFAOYSA-N.
| Molecular formula | C15H20BNO2 |
|---|---|
| Molecular weight | 257.14 g/mol |
| IUPAC name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanenitrile |
| InChIKey | OGOXYOXLPUUTJM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CCC#N |
Computed by PubChem (NCBI)