Products 1220349-37-0
CAS 1220349-37-0 is the registry number for Glucosamine-2-13C (hydrochloride), 99%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 5 mg, 25 mg.
(2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxy(213C)hexanal;hydrochloride (CAS 1220349-37-0) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 216.62 g/mol. IUPAC name: (2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxy(213C)hexanal;hydrochloride. InChIKey: CBOJBBMQJBVCMW-NGXWWYOQSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxy(213C)hexanal;hydrochloride |
| InChIKey | CBOJBBMQJBVCMW-NGXWWYOQSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([13C@H](C=O)N)O)O)O)O.Cl |
Computed by PubChem (NCBI)