CAS 1220526-74-8 is the registry number for 2-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)pyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine (CAS 1220526-74-8) is a chemical compound with the molecular formula C16H19BN2O2 and a molecular weight of 282.1 g/mol. IUPAC name: 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine. InChIKey: RJKNZUCBQAJCOL-UHFFFAOYSA-N.
| Molecular formula | C16H19BN2O2 |
|---|---|
| Molecular weight | 282.1 g/mol |
| IUPAC name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine |
| InChIKey | RJKNZUCBQAJCOL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=NC=CC=N3 |
Computed by PubChem (NCBI)