CAS 1622216-92-5 is the registry number for 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,2'-bipyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-pyridin-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1622216-92-5) is a chemical compound with the molecular formula C16H19BN2O2 and a molecular weight of 282.1 g/mol. IUPAC name: 2-pyridin-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: GOTHWAHQXVXCSC-UHFFFAOYSA-N.
| Molecular formula | C16H19BN2O2 |
|---|---|
| Molecular weight | 282.1 g/mol |
| IUPAC name | 2-pyridin-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | GOTHWAHQXVXCSC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)