CAS 1220710-28-0 appears in our catalog under these names: 3-(2,2-Dimethylbenzo[d][1,3]dioxol-5-yl)propanoic acid, 97%, 97%, 3-(2,2-DIMETHYL-2H-1,3-BENZODIOXOL-5-YL)PROPANOIC ACID, 97%, 3-(2,2-Dimethylbenzo[d][1,3]dioxol-5-yl)propanoic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-(2,2-dimethyl-1,3-benzodioxol-5-yl)propanoic acid (CAS 1220710-28-0) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 3-(2,2-dimethyl-1,3-benzodioxol-5-yl)propanoic acid. InChIKey: GPVMUDIVLDALJD-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3-(2,2-dimethyl-1,3-benzodioxol-5-yl)propanoic acid |
| InChIKey | GPVMUDIVLDALJD-UHFFFAOYSA-N |
| SMILES | CC1(OC2=C(O1)C=C(C=C2)CCC(=O)O)C |
Computed by PubChem (NCBI)