Products 1220869-25-9

CAS 1220869-25-9 is the registry number for Ethyl 2-methyl-4-vinylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 4-ethenyl-2-methylbenzoate (CAS 1220869-25-9) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: ethyl 4-ethenyl-2-methylbenzoate. InChIKey: CAAOFOPLNYBDTH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O2
Molecular weight190.24 g/mol
IUPAC nameethyl 4-ethenyl-2-methylbenzoate
InChIKeyCAAOFOPLNYBDTH-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C=C(C=C1)C=C)C

Computed by PubChem (NCBI)