CAS 1220869-25-9 is the registry number for Ethyl 2-methyl-4-vinylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Ethyl 4-ethenyl-2-methylbenzoate (CAS 1220869-25-9) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: ethyl 4-ethenyl-2-methylbenzoate. InChIKey: CAAOFOPLNYBDTH-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | ethyl 4-ethenyl-2-methylbenzoate |
| InChIKey | CAAOFOPLNYBDTH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)C=C)C |
Computed by PubChem (NCBI)