CAS 1220967-98-5 is the registry number for tert-Butyl 3-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)propanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoate (CAS 1220967-98-5) is a chemical compound with the molecular formula C16H27BN2O4 and a molecular weight of 322.2 g/mol. IUPAC name: tert-butyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoate. InChIKey: MBTXFWTZRGNWFD-UHFFFAOYSA-N.
| Molecular formula | C16H27BN2O4 |
|---|---|
| Molecular weight | 322.2 g/mol |
| IUPAC name | tert-butyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoate |
| InChIKey | MBTXFWTZRGNWFD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)