Products 852331-49-8
CAS 852331-49-8 appears in our catalog under these names: ((2R)-1-((3-Hydroxyadamantan-1-yl)glycyl)pyrrolidin-2-yl)boronic acid, 98+%, Vildagliptin Impurity 88, Vildagliptin-boronic Acid. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(2R)-1-[2-[(3-hydroxy-1-adamantyl)amino]acetyl]pyrrolidin-2-yl]boronic acid (CAS 852331-49-8) is a chemical compound with the molecular formula C16H27BN2O4 and a molecular weight of 322.2 g/mol. IUPAC name: [(2R)-1-[2-[(3-hydroxy-1-adamantyl)amino]acetyl]pyrrolidin-2-yl]boronic acid. InChIKey: NFCUDZZBVHLQSU-JFQZXIRVSA-N.
| Molecular formula | C16H27BN2O4 |
|---|---|
| Molecular weight | 322.2 g/mol |
| IUPAC name | [(2R)-1-[2-[(3-hydroxy-1-adamantyl)amino]acetyl]pyrrolidin-2-yl]boronic acid |
| InChIKey | NFCUDZZBVHLQSU-JFQZXIRVSA-N |
| SMILES | B([C@@H]1CCCN1C(=O)CNC23CC4CC(C2)CC(C4)(C3)O)(O)O |
Computed by PubChem (NCBI)