Products 122111-07-3
CAS 122111-07-3 appears in our catalog under these names: Gemcitabine Impurity 24, Gemcitabine impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R)-4,4-difluoro-2-(hydroxymethyl)-5-oxooxolan-3-yl] benzoate (CAS 122111-07-3) is a chemical compound with the molecular formula C12H10F2O5 and a molecular weight of 272.20 g/mol. IUPAC name: [(2R,3R)-4,4-difluoro-2-(hydroxymethyl)-5-oxooxolan-3-yl] benzoate. InChIKey: BIFWGBBUNCUGII-RKDXNWHRSA-N.
| Molecular formula | C12H10F2O5 |
|---|---|
| Molecular weight | 272.20 g/mol |
| IUPAC name | [(2R,3R)-4,4-difluoro-2-(hydroxymethyl)-5-oxooxolan-3-yl] benzoate |
| InChIKey | BIFWGBBUNCUGII-RKDXNWHRSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)O[C@@H]2[C@H](OC(=O)C2(F)F)CO |
Computed by PubChem (NCBI)