CAS 832741-03-4 appears in our catalog under these names: Methyl 4-(3-(difluoromethoxy)phenyl)-2,4-dioxobutanoate, 4-(3-Difluoromethoxy-phenyl)-2,4-dioxo-butyric acid methyl ester, 97%. Offered by: Biosynth, Fluorochem. Available pack sizes: 2,5g, 250mg, 50mg, 100mg, 1g, 2.5g.
Methyl 4-[3-(difluoromethoxy)phenyl]-2,4-dioxobutanoate (CAS 832741-03-4) is a chemical compound with the molecular formula C12H10F2O5 and a molecular weight of 272.20 g/mol. IUPAC name: methyl 4-[3-(difluoromethoxy)phenyl]-2,4-dioxobutanoate. InChIKey: PMKCCHJPKIEDSV-UHFFFAOYSA-N.
| Molecular formula | C12H10F2O5 |
|---|---|
| Molecular weight | 272.20 g/mol |
| IUPAC name | methyl 4-[3-(difluoromethoxy)phenyl]-2,4-dioxobutanoate |
| InChIKey | PMKCCHJPKIEDSV-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC(=CC=C1)OC(F)F |
Computed by PubChem (NCBI)