CAS 1221135-07-4 appears in our catalog under these names: 1-Bromo-6,7,8,9-tetrahydro-5H-benzo(7)annulen-5-ol, 95%, 1-Bromo-6,7,8,9-tetrahydro-5H-benzo(7)annulen-5-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-bromo-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-ol (CAS 1221135-07-4) is a chemical compound with the molecular formula C11H13BrO and a molecular weight of 241.12 g/mol. IUPAC name: 1-bromo-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-ol. InChIKey: ULWCKWUKHBHFEQ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 1-bromo-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-ol |
| InChIKey | ULWCKWUKHBHFEQ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C=CC=C2Br)C(C1)O |
Computed by PubChem (NCBI)