CAS 1221172-03-7 is the registry number for 2-Chloro-3-iodo-6-(trifluoromethoxy)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-3-iodo-6-(trifluoromethoxy)pyridine (CAS 1221172-03-7) is a chemical compound with the molecular formula C6H2ClF3INO and a molecular weight of 323.44 g/mol. IUPAC name: 2-chloro-3-iodo-6-(trifluoromethoxy)pyridine. InChIKey: AZPLTOZWQMTGIM-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3INO |
|---|---|
| Molecular weight | 323.44 g/mol |
| IUPAC name | 2-chloro-3-iodo-6-(trifluoromethoxy)pyridine |
| InChIKey | AZPLTOZWQMTGIM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1I)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)