CAS 1361496-09-4 is the registry number for 2-Chloro-6-iodo-3-(trifluoromethoxy)pyridine, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-chloro-6-iodo-3-(trifluoromethoxy)pyridine (CAS 1361496-09-4) is a chemical compound with the molecular formula C6H2ClF3INO and a molecular weight of 323.44 g/mol. IUPAC name: 2-chloro-6-iodo-3-(trifluoromethoxy)pyridine. InChIKey: JJFAQQMKXBDPRU-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3INO |
|---|---|
| Molecular weight | 323.44 g/mol |
| IUPAC name | 2-chloro-6-iodo-3-(trifluoromethoxy)pyridine |
| InChIKey | JJFAQQMKXBDPRU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1OC(F)(F)F)Cl)I |
Computed by PubChem (NCBI)