Products 122128-84-1
CAS 122128-84-1 appears in our catalog under these names: 1,3-Diphenyl-1H-pyrazole-4,5-diamine, 97%, Diphenyl-1H-pyrazole-4,5-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1,3-diphenylpyrazole-4,5-diamine (CAS 122128-84-1) is a chemical compound with the molecular formula C15H14N4 and a molecular weight of 250.30 g/mol. IUPAC name: 1,3-diphenylpyrazole-4,5-diamine. InChIKey: WVNRYHPYXYRWOU-UHFFFAOYSA-N.
| Molecular formula | C15H14N4 |
|---|---|
| Molecular weight | 250.30 g/mol |
| IUPAC name | 1,3-diphenylpyrazole-4,5-diamine |
| InChIKey | WVNRYHPYXYRWOU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C(=C2N)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)