CAS 258514-31-7 appears in our catalog under these names: N4-Benzylquinazoline-2,4-diamine, 95%, N4-Benzylquinazoline-2,4-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-N-benzylquinazoline-2,4-diamine (CAS 258514-31-7) is a chemical compound with the molecular formula C15H14N4 and a molecular weight of 250.30 g/mol. IUPAC name: 4-N-benzylquinazoline-2,4-diamine. InChIKey: AOPGZFMVGYJPSS-UHFFFAOYSA-N.
| Molecular formula | C15H14N4 |
|---|---|
| Molecular weight | 250.30 g/mol |
| IUPAC name | 4-N-benzylquinazoline-2,4-diamine |
| InChIKey | AOPGZFMVGYJPSS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NC(=NC3=CC=CC=C32)N |
Computed by PubChem (NCBI)