Products 1221722-29-7

CAS 1221722-29-7 is the registry number for 2,2,2-Trifluoroethyl N-(2,2,2-trifluoroethyl)carbamate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2,2,2-trifluoroethyl N-(2,2,2-trifluoroethyl)carbamate (CAS 1221722-29-7) is a chemical compound with the molecular formula C5H5F6NO2 and a molecular weight of 225.09 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(2,2,2-trifluoroethyl)carbamate. InChIKey: CBJPHCVYTHPREU-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5F6NO2
Molecular weight225.09 g/mol
IUPAC name2,2,2-trifluoroethyl N-(2,2,2-trifluoroethyl)carbamate
InChIKeyCBJPHCVYTHPREU-UHFFFAOYSA-N
SMILESC(C(F)(F)F)NC(=O)OCC(F)(F)F

Computed by PubChem (NCBI)