CAS 1221722-29-7 is the registry number for 2,2,2-Trifluoroethyl N-(2,2,2-trifluoroethyl)carbamate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2,2,2-trifluoroethyl N-(2,2,2-trifluoroethyl)carbamate (CAS 1221722-29-7) is a chemical compound with the molecular formula C5H5F6NO2 and a molecular weight of 225.09 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(2,2,2-trifluoroethyl)carbamate. InChIKey: CBJPHCVYTHPREU-UHFFFAOYSA-N.
| Molecular formula | C5H5F6NO2 |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(2,2,2-trifluoroethyl)carbamate |
| InChIKey | CBJPHCVYTHPREU-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)