CAS 16063-80-2 appears in our catalog under these names: Hexafluoro-dl-valine, 95%, 4,4,4,4',4',4'-Hexafluoro-DL-valine, 97%, 4,4,4,4',4',4'–Hexafluoro–DL–valine, 4,4,4,4',4',4'-HEXAFLUORO-DL-VALINE, 97&, Valine, 4,4,4,4',4',4'-hexafluoro-, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 5g, 1g, 250mg, 50mg, 100mg.
2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid (CAS 16063-80-2) is a chemical compound with the molecular formula C5H5F6NO2 and a molecular weight of 225.09 g/mol. IUPAC name: 2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid. InChIKey: KRNSHCKTGFAMPQ-UHFFFAOYSA-N.
| Molecular formula | C5H5F6NO2 |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid |
| InChIKey | KRNSHCKTGFAMPQ-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)F)C(F)(F)F)(C(=O)O)N |
Computed by PubChem (NCBI)