CAS 1221725-41-2 appears in our catalog under these names: 1-(3-(4-Fluorophenyl)-1,2,4-oxadiazol-5-yl)ethan-1-amine hydrochloride, 95%, 1-(3-(4-Fluorophenyl)-1,2,4-oxadiazol-5-yl)ethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride (CAS 1221725-41-2) is a chemical compound with the molecular formula C10H11ClFN3O and a molecular weight of 243.66 g/mol. IUPAC name: 1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride. InChIKey: XEACNDUKAUTLNM-UHFFFAOYSA-N.
| Molecular formula | C10H11ClFN3O |
|---|---|
| Molecular weight | 243.66 g/mol |
| IUPAC name | 1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride |
| InChIKey | XEACNDUKAUTLNM-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=NO1)C2=CC=C(C=C2)F)N.Cl |
Computed by PubChem (NCBI)