CAS 1306604-81-8 is the registry number for 1-(2-Fluorophenyl)-1-(5-methyl-1,2,4-oxadiazol-3-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2-fluorophenyl)-(5-methyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride (CAS 1306604-81-8) is a chemical compound with the molecular formula C10H11ClFN3O and a molecular weight of 243.66 g/mol. IUPAC name: (2-fluorophenyl)-(5-methyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride. InChIKey: CSOOWMUMKFKOLY-UHFFFAOYSA-N.
| Molecular formula | C10H11ClFN3O |
|---|---|
| Molecular weight | 243.66 g/mol |
| IUPAC name | (2-fluorophenyl)-(5-methyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride |
| InChIKey | CSOOWMUMKFKOLY-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)C(C2=CC=CC=C2F)N.Cl |
Computed by PubChem (NCBI)