Products 1221725-87-6
CAS 1221725-87-6 is the registry number for 4-(2,3-Dihydro-1H-indol-5-ylmethyl)aniline. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-(2,3-dihydro-1H-indol-5-ylmethyl)aniline (CAS 1221725-87-6) is a chemical compound with the molecular formula C15H16N2 and a molecular weight of 224.30 g/mol. IUPAC name: 4-(2,3-dihydro-1H-indol-5-ylmethyl)aniline. InChIKey: KXMNPYKIVCLNIA-UHFFFAOYSA-N.
| Molecular formula | C15H16N2 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 4-(2,3-dihydro-1H-indol-5-ylmethyl)aniline |
| InChIKey | KXMNPYKIVCLNIA-UHFFFAOYSA-N |
| SMILES | C1CNC2=C1C=C(C=C2)CC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)