CAS 1221726-05-1 is the registry number for 3-Amino-2-(2-chlorophenyl)-1,1,1-trifluoropropan-2-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-amino-2-(2-chlorophenyl)-1,1,1-trifluoropropan-2-ol;hydrochloride (CAS 1221726-05-1) is a chemical compound with the molecular formula C9H10Cl2F3NO and a molecular weight of 276.08 g/mol. IUPAC name: 3-amino-2-(2-chlorophenyl)-1,1,1-trifluoropropan-2-ol;hydrochloride. InChIKey: QGNUUIMSOPLYBL-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2F3NO |
|---|---|
| Molecular weight | 276.08 g/mol |
| IUPAC name | 3-amino-2-(2-chlorophenyl)-1,1,1-trifluoropropan-2-ol;hydrochloride |
| InChIKey | QGNUUIMSOPLYBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(CN)(C(F)(F)F)O)Cl.Cl |
Computed by PubChem (NCBI)