CAS 1701984-81-7 appears in our catalog under these names: 2-Amino-2-[4-chloro-2-(trifluoromethyl)phenyl]ethan-1-ol hydrochloride, 95%, 2-Amino-2-(4-chloro-2-(trifluoromethyl)phenyl)ethan-1-ol hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
2-amino-2-[4-chloro-2-(trifluoromethyl)phenyl]ethanol;hydrochloride (CAS 1701984-81-7) is a chemical compound with the molecular formula C9H10Cl2F3NO and a molecular weight of 276.08 g/mol. IUPAC name: 2-amino-2-[4-chloro-2-(trifluoromethyl)phenyl]ethanol;hydrochloride. InChIKey: PYCBHPCZILUBPN-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2F3NO |
|---|---|
| Molecular weight | 276.08 g/mol |
| IUPAC name | 2-amino-2-[4-chloro-2-(trifluoromethyl)phenyl]ethanol;hydrochloride |
| InChIKey | PYCBHPCZILUBPN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)C(CO)N.Cl |
Computed by PubChem (NCBI)