Products 1803600-54-5

CAS 1803600-54-5 appears in our catalog under these names: Benzyl 3,5-dimethylpiperazine-1-carboxylate hydrochloride, 95%, Benzyl 3,5-dimethylpiperazine-1-carboxylate hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.

Structural formula: {0} (CAS {1})

Benzyl 3,5-dimethylpiperazine-1-carboxylate;hydrochloride (CAS 1803600-54-5) is a chemical compound with the molecular formula C14H21ClN2O2 and a molecular weight of 284.78 g/mol. IUPAC name: benzyl 3,5-dimethylpiperazine-1-carboxylate;hydrochloride. InChIKey: XNSJNYIJYTYLMM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21ClN2O2
Molecular weight284.78 g/mol
IUPAC namebenzyl 3,5-dimethylpiperazine-1-carboxylate;hydrochloride
InChIKeyXNSJNYIJYTYLMM-UHFFFAOYSA-N
SMILESCC1CN(CC(N1)C)C(=O)OCC2=CC=CC=C2.Cl

Computed by PubChem (NCBI)