CAS 1221728-86-4 appears in our catalog under these names: N-(4-Chloro-2-fluorophenyl)-2-(n-hydroxyimino)acetamide, 95%, N-(4-Chloro-2-fluorophenyl)-2-(N-hydroxyimino)acetamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(2E)-N-(4-chloro-2-fluorophenyl)-2-hydroxyiminoacetamide (CAS 1221728-86-4) is a chemical compound with the molecular formula C8H6ClFN2O2 and a molecular weight of 216.60 g/mol. IUPAC name: (2E)-N-(4-chloro-2-fluorophenyl)-2-hydroxyiminoacetamide. InChIKey: PMHDWIOOTCBSKU-NYYWCZLTSA-N.
| Molecular formula | C8H6ClFN2O2 |
|---|---|
| Molecular weight | 216.60 g/mol |
| IUPAC name | (2E)-N-(4-chloro-2-fluorophenyl)-2-hydroxyiminoacetamide |
| InChIKey | PMHDWIOOTCBSKU-NYYWCZLTSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)NC(=O)/C=N/O |
Computed by PubChem (NCBI)