CAS 2137598-21-9 is the registry number for 5-Fluoro-1H-1,3-benzodiazole-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-fluoro-1H-benzimidazole-4-carboxylic acid;hydrochloride (CAS 2137598-21-9) is a chemical compound with the molecular formula C8H6ClFN2O2 and a molecular weight of 216.60 g/mol. IUPAC name: 5-fluoro-1H-benzimidazole-4-carboxylic acid;hydrochloride. InChIKey: FDWYDDLYGFRNGO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFN2O2 |
|---|---|
| Molecular weight | 216.60 g/mol |
| IUPAC name | 5-fluoro-1H-benzimidazole-4-carboxylic acid;hydrochloride |
| InChIKey | FDWYDDLYGFRNGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NC=N2)C(=O)O)F.Cl |
Computed by PubChem (NCBI)