Products 2137598-21-9

CAS 2137598-21-9 is the registry number for 5-Fluoro-1H-1,3-benzodiazole-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-fluoro-1H-benzimidazole-4-carboxylic acid;hydrochloride (CAS 2137598-21-9) is a chemical compound with the molecular formula C8H6ClFN2O2 and a molecular weight of 216.60 g/mol. IUPAC name: 5-fluoro-1H-benzimidazole-4-carboxylic acid;hydrochloride. InChIKey: FDWYDDLYGFRNGO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClFN2O2
Molecular weight216.60 g/mol
IUPAC name5-fluoro-1H-benzimidazole-4-carboxylic acid;hydrochloride
InChIKeyFDWYDDLYGFRNGO-UHFFFAOYSA-N
SMILESC1=CC(=C(C2=C1NC=N2)C(=O)O)F.Cl

Computed by PubChem (NCBI)