CAS 1221793-68-5 appears in our catalog under these names: 3-Chloro-5-fluoropyridine 1-oxide, 96%, 3-Chloro-5-fluoropyridine 1-oxide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg.
3-chloro-5-fluoro-1-oxidopyridin-1-ium (CAS 1221793-68-5) is a chemical compound with the molecular formula C5H3ClFNO and a molecular weight of 147.53 g/mol. IUPAC name: 3-chloro-5-fluoro-1-oxidopyridin-1-ium. InChIKey: KAZGNPCUIRKMRY-UHFFFAOYSA-N.
| Molecular formula | C5H3ClFNO |
|---|---|
| Molecular weight | 147.53 g/mol |
| IUPAC name | 3-chloro-5-fluoro-1-oxidopyridin-1-ium |
| InChIKey | KAZGNPCUIRKMRY-UHFFFAOYSA-N |
| SMILES | C1=C(C=[N+](C=C1Cl)[O-])F |
Computed by PubChem (NCBI)