CAS 85386-94-3 appears in our catalog under these names: 2–Chloro–3–fluoropyridine 1–oxide, 2-Chloro-3-fluoropyridine 1-oxide, 95%, 2-Chloro-3-fluoropyridine 1-oxide, 95%, 95%. Offered by: GLPBio, Combi-blocks, Chemat. Available pack sizes: 100mg, 1g, 250mg.
2-chloro-3-fluoro-1-oxidopyridin-1-ium (CAS 85386-94-3) is a chemical compound with the molecular formula C5H3ClFNO and a molecular weight of 147.53 g/mol. IUPAC name: 2-chloro-3-fluoro-1-oxidopyridin-1-ium. InChIKey: DPLJAKHIJWQGJM-UHFFFAOYSA-N.
| Molecular formula | C5H3ClFNO |
|---|---|
| Molecular weight | 147.53 g/mol |
| IUPAC name | 2-chloro-3-fluoro-1-oxidopyridin-1-ium |
| InChIKey | DPLJAKHIJWQGJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C([N+](=C1)[O-])Cl)F |
Computed by PubChem (NCBI)