Products 1221818-66-1

CAS 1221818-66-1 is the registry number for 10,10-Difluoro-2,7-diaza-spiro[4.5]decane-7-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 10,10-difluoro-2,7-diazaspiro[4.5]decane-7-carboxylate (CAS 1221818-66-1) is a chemical compound with the molecular formula C13H22F2N2O2 and a molecular weight of 276.32 g/mol. IUPAC name: tert-butyl 10,10-difluoro-2,7-diazaspiro[4.5]decane-7-carboxylate. InChIKey: YJGYLCWXJRNFPU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H22F2N2O2
Molecular weight276.32 g/mol
IUPAC nametert-butyl 10,10-difluoro-2,7-diazaspiro[4.5]decane-7-carboxylate
InChIKeyYJGYLCWXJRNFPU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(C2(C1)CCNC2)(F)F

Computed by PubChem (NCBI)