CAS 2714411-90-0 is the registry number for Rel-tert-butyl ((3aS,7aR)-6,6-difluorooctahydro-3aH-isoindol-3a-yl)carbamate, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Tert-butyl N-[(3aS,7aR)-6,6-difluoro-2,3,4,5,7,7a-hexahydro-1H-isoindol-3a-yl]carbamate (CAS 2714411-90-0) is a chemical compound with the molecular formula C13H22F2N2O2 and a molecular weight of 276.32 g/mol. IUPAC name: tert-butyl N-[(3aS,7aR)-6,6-difluoro-2,3,4,5,7,7a-hexahydro-1H-isoindol-3a-yl]carbamate. InChIKey: MDGIIAAKBKCPTL-BXKDBHETSA-N.
| Molecular formula | C13H22F2N2O2 |
|---|---|
| Molecular weight | 276.32 g/mol |
| IUPAC name | tert-butyl N-[(3aS,7aR)-6,6-difluoro-2,3,4,5,7,7a-hexahydro-1H-isoindol-3a-yl]carbamate |
| InChIKey | MDGIIAAKBKCPTL-BXKDBHETSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@]12CCC(C[C@@H]1CNC2)(F)F |
Computed by PubChem (NCBI)