Products 1221824-16-3

CAS 1221824-16-3 is the registry number for 4-(2-Phenylethoxy)phenylboronic acid pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4,4,5,5-tetramethyl-2-[4-(2-phenylethoxy)phenyl]-1,3,2-dioxaborolane (CAS 1221824-16-3) is a chemical compound with the molecular formula C20H25BO3 and a molecular weight of 324.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-(2-phenylethoxy)phenyl]-1,3,2-dioxaborolane. InChIKey: XNMMDTNMHZSXOR-UHFFFAOYSA-N.

Identity
Molecular formulaC20H25BO3
Molecular weight324.2 g/mol
IUPAC name4,4,5,5-tetramethyl-2-[4-(2-phenylethoxy)phenyl]-1,3,2-dioxaborolane
InChIKeyXNMMDTNMHZSXOR-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCC3=CC=CC=C3

Computed by PubChem (NCBI)