CAS 2621937-65-1 is the registry number for 2-(2-(Benzyloxy)-6-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4,5,5-tetramethyl-2-(2-methyl-6-phenylmethoxyphenyl)-1,3,2-dioxaborolane (CAS 2621937-65-1) is a chemical compound with the molecular formula C20H25BO3 and a molecular weight of 324.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methyl-6-phenylmethoxyphenyl)-1,3,2-dioxaborolane. InChIKey: ZYXSQFKVPDCGGC-UHFFFAOYSA-N.
| Molecular formula | C20H25BO3 |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methyl-6-phenylmethoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | ZYXSQFKVPDCGGC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC=C2OCC3=CC=CC=C3)C |
Computed by PubChem (NCBI)