CAS 1221885-61-5 is the registry number for 6,7-Dimethoxy-3,4-dihydroisoquinoline-d6. Offered by: MedChemExpress. Available pack sizes: Get quote.
6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline (CAS 1221885-61-5) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 197.26 g/mol. IUPAC name: 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline. InChIKey: NSLJVQUDZCZJLK-WFGJKAKNSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline |
| InChIKey | NSLJVQUDZCZJLK-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C2C=NCCC2=C1)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)