Products 1221923-43-8
CAS 1221923-43-8 appears in our catalog under these names: Pinobanksin 3–(2–methyl)butyrate, Pinobanksin 3-(2-methyl)butyrate. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
[(2R,3R)-5,7-dihydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-3-yl] 2-methylbutanoate (CAS 1221923-43-8) is a chemical compound with the molecular formula C20H20O6 and a molecular weight of 356.4 g/mol. IUPAC name: [(2R,3R)-5,7-dihydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-3-yl] 2-methylbutanoate. InChIKey: ZDDSHWOLTYMTJG-VEQZCADJSA-N.
| Molecular formula | C20H20O6 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | [(2R,3R)-5,7-dihydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-3-yl] 2-methylbutanoate |
| InChIKey | ZDDSHWOLTYMTJG-VEQZCADJSA-N |
| SMILES | CCC(C)C(=O)O[C@@H]1[C@H](OC2=CC(=CC(=C2C1=O)O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)