Products 1872403-23-0
CAS 1872403-23-0 is the registry number for Kimcuongin. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
[1-(7-methoxy-2-oxochromen-8-yl)-3-methyl-1-oxobut-2-en-2-yl] 3-methylbut-2-enoate (CAS 1872403-23-0) is a chemical compound with the molecular formula C20H20O6 and a molecular weight of 356.4 g/mol. IUPAC name: [1-(7-methoxy-2-oxochromen-8-yl)-3-methyl-1-oxobut-2-en-2-yl] 3-methylbut-2-enoate. InChIKey: VALIYXXMXXVKDP-UHFFFAOYSA-N.
| Molecular formula | C20H20O6 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | [1-(7-methoxy-2-oxochromen-8-yl)-3-methyl-1-oxobut-2-en-2-yl] 3-methylbut-2-enoate |
| InChIKey | VALIYXXMXXVKDP-UHFFFAOYSA-N |
| SMILES | CC(=CC(=O)OC(=C(C)C)C(=O)C1=C(C=CC2=C1OC(=O)C=C2)OC)C |
Computed by PubChem (NCBI)
Synonyms:
Kimcuongin, orb1682254