CAS 1222491-53-3 is the registry number for tert-Butyl ((3r,6r)-rel-6-methylpiperidin-3-yl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl N-[(3R,6R)-6-methylpiperidin-3-yl]carbamate (CAS 1222491-53-3) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(3R,6R)-6-methylpiperidin-3-yl]carbamate. InChIKey: NNMBHCRWGGSRBE-RKDXNWHRSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(3R,6R)-6-methylpiperidin-3-yl]carbamate |
| InChIKey | NNMBHCRWGGSRBE-RKDXNWHRSA-N |
| SMILES | C[C@@H]1CC[C@H](CN1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)