CAS 122269-03-8 appears in our catalog under these names: 2-(tert-Butyl)-4-(tert-pentyl)phenol, 95%, 2–T–butyl–4–(1,1–dimethylpropyl)–phenol, 2-TERT-BUTYL-4-(1,1-DIMETHYLPROPYL)PHENOL, 95%, 95%, 2-TERT-BUTYL-4-(1,1-DIMETHYLPROPYL)PHENOL, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-tert-butyl-4-(2-methylbutan-2-yl)phenol (CAS 122269-03-8) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: 2-tert-butyl-4-(2-methylbutan-2-yl)phenol. InChIKey: NZRSIUKTGLRKIQ-UHFFFAOYSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | 2-tert-butyl-4-(2-methylbutan-2-yl)phenol |
| InChIKey | NZRSIUKTGLRKIQ-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC(=C(C=C1)O)C(C)(C)C |
Computed by PubChem (NCBI)