CAS 141214-18-8 appears in our catalog under these names: 2-Isopropoxy-1,3-diisopropylbenzene, 95%, Propofol EP Impurity G, Propofol Isopropyl Ether, 2-(1-Methylethoxy)-1,3-bis(1-methylethyl)benzene, 2-Isopropoxy-1,3-diisopropylbenzene, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, LoGiCal. Available pack sizes: 5g, 25g, 1g, 10g, on request, 100mg, 10mg, 50mg.
1,3-di(propan-2-yl)-2-propan-2-yloxybenzene (CAS 141214-18-8) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: 1,3-di(propan-2-yl)-2-propan-2-yloxybenzene. InChIKey: APXUVWNNDMEOEC-UHFFFAOYSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | 1,3-di(propan-2-yl)-2-propan-2-yloxybenzene |
| InChIKey | APXUVWNNDMEOEC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)OC(C)C |
Computed by PubChem (NCBI)