CAS 1222709-27-4 appears in our catalog under these names: tert-Butyl trans-3-(aminomethyl)cyclohexylcarbamate, 95%, tert-Butyl ((1R,3R)-3-(Aminomethyl)cyclohexyl)carbamate. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 100mg.
Tert-butyl N-[(1R,3R)-3-(aminomethyl)cyclohexyl]carbamate (CAS 1222709-27-4) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl N-[(1R,3R)-3-(aminomethyl)cyclohexyl]carbamate. InChIKey: OJNXXJZVUYXMLE-NXEZZACHSA-N.
| Molecular formula | C12H24N2O2 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | tert-butyl N-[(1R,3R)-3-(aminomethyl)cyclohexyl]carbamate |
| InChIKey | OJNXXJZVUYXMLE-NXEZZACHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](C1)CN |
Computed by PubChem (NCBI)