CAS 1821791-21-2 is the registry number for tert-Butyl ((1S,3R)-3-(aminomethyl)cyclohexyl)carbamate, 97%. Offered by: AmBeed. Available pack sizes: 5g, 100mg, 250mg.
Tert-butyl N-[(1S,3R)-3-(aminomethyl)cyclohexyl]carbamate (CAS 1821791-21-2) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl N-[(1S,3R)-3-(aminomethyl)cyclohexyl]carbamate. InChIKey: OJNXXJZVUYXMLE-ZJUUUORDSA-N.
| Molecular formula | C12H24N2O2 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | tert-butyl N-[(1S,3R)-3-(aminomethyl)cyclohexyl]carbamate |
| InChIKey | OJNXXJZVUYXMLE-ZJUUUORDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC[C@H](C1)CN |
Computed by PubChem (NCBI)