Products 1223-36-5

CAS 1223-36-5 is the registry number for Clofexamide. Offered by: MedChemExpress. Available pack sizes: 5 mg, 50 mg, 10 mg, 1 mg, 25 mg.

Structural formula: {0} (CAS {1})

2-(4-chlorophenoxy)-N-[2-(diethylamino)ethyl]acetamide (CAS 1223-36-5) is a chemical compound with the molecular formula C14H21ClN2O2 and a molecular weight of 284.78 g/mol. IUPAC name: 2-(4-chlorophenoxy)-N-[2-(diethylamino)ethyl]acetamide. InChIKey: UORGKWWJEQDTGX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21ClN2O2
Molecular weight284.78 g/mol
IUPAC name2-(4-chlorophenoxy)-N-[2-(diethylamino)ethyl]acetamide
InChIKeyUORGKWWJEQDTGX-UHFFFAOYSA-N
SMILESCCN(CC)CCNC(=O)COC1=CC=C(C=C1)Cl

Computed by PubChem (NCBI)