Products 1223184-71-1
CAS 1223184-71-1 is the registry number for 6-Chloro-N4-cyclopropyl-N4-ethylpyrimidine-2,4-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-4-N-cyclopropyl-4-N-ethylpyrimidine-2,4-diamine (CAS 1223184-71-1) is a chemical compound with the molecular formula C9H13ClN4 and a molecular weight of 212.68 g/mol. IUPAC name: 6-chloro-4-N-cyclopropyl-4-N-ethylpyrimidine-2,4-diamine. InChIKey: AZTGPCLNELFFHA-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN4 |
|---|---|
| Molecular weight | 212.68 g/mol |
| IUPAC name | 6-chloro-4-N-cyclopropyl-4-N-ethylpyrimidine-2,4-diamine |
| InChIKey | AZTGPCLNELFFHA-UHFFFAOYSA-N |
| SMILES | CCN(C1CC1)C2=CC(=NC(=N2)N)Cl |
Computed by PubChem (NCBI)