CAS 1261079-56-4 is the registry number for 6-Chloro-2-(piperazin-1-yl)pyridin-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
6-chloro-2-piperazin-1-ylpyridin-3-amine (CAS 1261079-56-4) is a chemical compound with the molecular formula C9H13ClN4 and a molecular weight of 212.68 g/mol. IUPAC name: 6-chloro-2-piperazin-1-ylpyridin-3-amine. InChIKey: FMTNTOUEYHYIFH-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN4 |
|---|---|
| Molecular weight | 212.68 g/mol |
| IUPAC name | 6-chloro-2-piperazin-1-ylpyridin-3-amine |
| InChIKey | FMTNTOUEYHYIFH-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=CC(=N2)Cl)N |
Computed by PubChem (NCBI)