CAS 122329-01-5 is the registry number for 1-Butoxy-3-nitro-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-butoxy-3-nitrobenzene (CAS 122329-01-5) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 1-butoxy-3-nitrobenzene. InChIKey: ZYRDOYFKUWNBSQ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 1-butoxy-3-nitrobenzene |
| InChIKey | ZYRDOYFKUWNBSQ-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=CC(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)