CAS 122351-86-4 appears in our catalog under these names: 2-(4-Bromophenyl)-5-chloro-1,3-benzoxazole, 95%, 2-(4-Bromophenyl)-5-chlorobenzo[d]oxazole, 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 250mg, 5g.
2-(4-bromophenyl)-5-chloro-1,3-benzoxazole (CAS 122351-86-4) is a chemical compound with the molecular formula C13H7BrClNO and a molecular weight of 308.56 g/mol. IUPAC name: 2-(4-bromophenyl)-5-chloro-1,3-benzoxazole. InChIKey: CPHRDAGIDJZPDC-UHFFFAOYSA-N.
| Molecular formula | C13H7BrClNO |
|---|---|
| Molecular weight | 308.56 g/mol |
| IUPAC name | 2-(4-bromophenyl)-5-chloro-1,3-benzoxazole |
| InChIKey | CPHRDAGIDJZPDC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(O2)C=CC(=C3)Cl)Br |
Computed by PubChem (NCBI)